C21H26BF5O6 — CID 175806331
3-[3,4-difluoro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylic acid (PubChem CID 175806331) has the molecular formula C21H26BF5O6 and a molecular weight of 480.24 g/mol. Its IUPAC name is 3-[3,4-difluoro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylic acid.
| Compound Name | 3-[3,4-difluoro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 175806331 |
| Molecular Formula | C21H26BF5O6 |
| Molecular Weight | 480.24 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 3-[3,4-difluoro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylic acid |
| SMILES | COc1c(C2C(C(=O)O)OC(C)(C(F)(F)F)C2C)cc(B2OC(C)(C)C(C)(C)O2)c(F)c1F |
| InChI | InChI=1S/C21H26BF5O6/c1-9-12(16(17(28)29)31-20(9,6)21(25,26)27)10-8-11(13(23)14(24)15(10)30-7)22-32-18(2,3)19(4,5)33-22/h8-9,12,16H,1-7H3,(H,28,29) |
| InChIKey | BRXRSBUYCDZNPB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.24 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|