C16H16ClF5O3 — CID 159086042
methyl (2S,3S,4S,5R)-3-(5-chloro-3,4-difluoro-2-methylphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylate (PubChem CID 159086042) has the molecular formula C16H16ClF5O3 and a molecular weight of 386.74 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R)-3-(5-chloro-3,4-difluoro-2-methylphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R)-3-(5-chloro-3,4-difluoro-2-methylphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylate |
|---|---|
| PubChem CID | 159086042 |
| Molecular Formula | C16H16ClF5O3 |
| Molecular Weight | 386.74 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | methyl (2S,3S,4S,5R)-3-(5-chloro-3,4-difluoro-2-methylphenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@](C)(C(F)(F)F)[C@@H](C)[C@H]1c1cc(Cl)c(F)c(F)c1C |
| InChI | InChI=1S/C16H16ClF5O3/c1-6-8(5-9(17)12(19)11(6)18)10-7(2)15(3,16(20,21)22)25-13(10)14(23)24-4/h5,7,10,13H,1-4H3/t7-,10-,13-,15+/m0/s1 |
| InChIKey | XHXOAMGAPIVFSW-ARRXHYNKSA-N |
| XLogP | 4.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.74 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|