C15H14F5IO4 — CID 175542270
methyl (2R)-3-(3,4-difluoro-2-hydroxy-5-iodophenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylate (PubChem CID 175542270) has the molecular formula C15H14F5IO4 and a molecular weight of 480.17 g/mol. Its IUPAC name is methyl (2R)-3-(3,4-difluoro-2-hydroxy-5-iodophenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylate.
| Compound Name | methyl (2R)-3-(3,4-difluoro-2-hydroxy-5-iodophenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylate |
|---|---|
| PubChem CID | 175542270 |
| Molecular Formula | C15H14F5IO4 |
| Molecular Weight | 480.17 g/mol |
| Exact Mass | 479.99 |
| IUPAC Name | methyl (2R)-3-(3,4-difluoro-2-hydroxy-5-iodophenyl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1OC(C)(C(F)(F)F)C(C)C1c1cc(I)c(F)c(F)c1O |
| InChI | InChI=1S/C15H14F5IO4/c1-5-8(6-4-7(21)9(16)10(17)11(6)22)12(13(23)24-3)25-14(5,2)15(18,19)20/h4-5,8,12,22H,1-3H3/t5?,8?,12-,14?/m1/s1 |
| InChIKey | NHVNRUYNFQUUMH-VZKPCUSOSA-N |
| XLogP | 3.89 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.17 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|