C13H13F5O3S — CID 176905075
(2R,3S,4S,5R)-3-(3,4-difluoro-5-methylthiophen-2-yl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylic acid (PubChem CID 176905075) has the molecular formula C13H13F5O3S and a molecular weight of 344.30 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-(3,4-difluoro-5-methylthiophen-2-yl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylic acid.
| Compound Name | (2R,3S,4S,5R)-3-(3,4-difluoro-5-methylthiophen-2-yl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 176905075 |
| Molecular Formula | C13H13F5O3S |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | (2R,3S,4S,5R)-3-(3,4-difluoro-5-methylthiophen-2-yl)-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylic acid |
| SMILES | Cc1sc([C@@H]2[C@H](C(=O)O)O[C@@](C)(C(F)(F)F)[C@H]2C)c(F)c1F |
| InChI | InChI=1S/C13H13F5O3S/c1-4-6(10-8(15)7(14)5(2)22-10)9(11(19)20)21-12(4,3)13(16,17)18/h4,6,9H,1-3H3,(H,19,20)/t4-,6-,9+,12+/m0/s1 |
| InChIKey | MRHAFDVUYAZXKG-WTWHUGEYSA-N |
| XLogP | 3.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |