C24H33F5O5Si — CID 171478534
(2R,3S,4S,5R)-3-[2-[3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]oxy-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylic acid (PubChem CID 171478534) has the molecular formula C24H33F5O5Si and a molecular weight of 524.60 g/mol. Its IUPAC name is (2R,3S,4S,5R)-3-[2-[3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]oxy-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylic acid.
| Compound Name | (2R,3S,4S,5R)-3-[2-[3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]oxy-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 171478534 |
| Molecular Formula | C24H33F5O5Si |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | (2R,3S,4S,5R)-3-[2-[3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]oxy-3,4-difluorophenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxylic acid |
| SMILES | C[C@H]1[C@@H](c2ccc(F)c(F)c2OC2CC(O[Si](C)(C)C(C)(C)C)C2)[C@H](C(=O)O)O[C@@]1(C)C(F)(F)F |
| InChI | InChI=1S/C24H33F5O5Si/c1-12-17(20(21(30)31)33-23(12,5)24(27,28)29)15-8-9-16(25)18(26)19(15)32-13-10-14(11-13)34-35(6,7)22(2,3)4/h8-9,12-14,17,20H,10-11H2,1-7H3,(H,30,31)/t12-,13?,14?,17-,20+,23+/m0/s1 |
| InChIKey | VLWJGLYJHLHHTH-FYBNIFHFSA-N |
| XLogP | 6.42 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|