C15H18F2O5 — CID 167212513
(2R,3S,4S)-3-(3,4-difluoro-5-hydroxy-2-methoxyphenyl)-4,5,5-trimethyloxolane-2-carboxylic acid (PubChem CID 167212513) has the molecular formula C15H18F2O5 and a molecular weight of 316.30 g/mol. Its IUPAC name is (2R,3S,4S)-3-(3,4-difluoro-5-hydroxy-2-methoxyphenyl)-4,5,5-trimethyloxolane-2-carboxylic acid.
| Compound Name | (2R,3S,4S)-3-(3,4-difluoro-5-hydroxy-2-methoxyphenyl)-4,5,5-trimethyloxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 167212513 |
| Molecular Formula | C15H18F2O5 |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (2R,3S,4S)-3-(3,4-difluoro-5-hydroxy-2-methoxyphenyl)-4,5,5-trimethyloxolane-2-carboxylic acid |
| SMILES | COc1c([C@H]2[C@H](C(=O)O)OC(C)(C)[C@H]2C)cc(O)c(F)c1F |
| InChI | InChI=1S/C15H18F2O5/c1-6-9(13(14(19)20)22-15(6,2)3)7-5-8(18)10(16)11(17)12(7)21-4/h5-6,9,13,18H,1-4H3,(H,19,20)/t6-,9-,13+/m0/s1 |
| InChIKey | GGGUFPNIUJOJAD-QLFJKWQLSA-N |
| XLogP | 2.66 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |