C22H43NO5S2 — CID 169051647
(2R)-2-[3-[2-(3,3-dimethylbutoxy)ethoxy]propanoylamino]-3-(3,3-dimethylbutyldisulfanyl)-3-methylbutanoic acid (PubChem CID 169051647) has the molecular formula C22H43NO5S2 and a molecular weight of 465.72 g/mol. Its IUPAC name is (2R)-2-[3-[2-(3,3-dimethylbutoxy)ethoxy]propanoylamino]-3-(3,3-dimethylbutyldisulfanyl)-3-methylbutanoic acid.
| Compound Name | (2R)-2-[3-[2-(3,3-dimethylbutoxy)ethoxy]propanoylamino]-3-(3,3-dimethylbutyldisulfanyl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 169051647 |
| Molecular Formula | C22H43NO5S2 |
| Molecular Weight | 465.72 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | (2R)-2-[3-[2-(3,3-dimethylbutoxy)ethoxy]propanoylamino]-3-(3,3-dimethylbutyldisulfanyl)-3-methylbutanoic acid |
| SMILES | CC(C)(C)CCOCCOCCC(=O)N[C@H](C(=O)O)C(C)(C)SSCCC(C)(C)C |
| InChI | InChI=1S/C22H43NO5S2/c1-20(2,3)10-13-28-15-14-27-12-9-17(24)23-18(19(25)26)22(7,8)30-29-16-11-21(4,5)6/h18H,9-16H2,1-8H3,(H,23,24)(H,25,26)/t18-/m1/s1 |
| InChIKey | DVDKGPMJMALDEO-GOSISDBHSA-N |
| XLogP | 5.01 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.72 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|