C33H43F3N8O3 — CID 169052175
1-[2-methyl-3-[(2,4,6-trifluoro-3,5-dimethylbenzoyl)amino]-4-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-N-(3-morpholin-4-ylpropyl)triazole-4-carboxamide (PubChem CID 169052175) has the molecular formula C33H43F3N8O3 and a molecular weight of 656.75 g/mol. Its IUPAC name is 1-[2-methyl-3-[(2,4,6-trifluoro-3,5-dimethylbenzoyl)amino]-4-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-N-(3-morpholin-4-ylpropyl)triazole-4-carboxamide.
| Compound Name | 1-[2-methyl-3-[(2,4,6-trifluoro-3,5-dimethylbenzoyl)amino]-4-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-N-(3-morpholin-4-ylpropyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 169052175 |
| Molecular Formula | C33H43F3N8O3 |
| Molecular Weight | 656.75 g/mol |
| Exact Mass | 656.34 |
| IUPAC Name | 1-[2-methyl-3-[(2,4,6-trifluoro-3,5-dimethylbenzoyl)amino]-4-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-N-(3-morpholin-4-ylpropyl)triazole-4-carboxamide |
| SMILES | Cc1c(F)c(C)c(F)c(C(=O)Nc2c(N3C[C@@H](C)N(C)[C@@H](C)C3)ccc(-n3cc(C(=O)NCCCN4CCOCC4)nn3)c2C)c1F |
| InChI | InChI=1S/C33H43F3N8O3/c1-19-16-43(17-20(2)41(19)6)26-9-8-25(21(3)31(26)38-33(46)27-29(35)22(4)28(34)23(5)30(27)36)44-18-24(39-40-44)32(45)37-10-7-11-42-12-14-47-15-13-42/h8-9,18-20H,7,10-17H2,1-6H3,(H,37,45)(H,38,46)/t19-,20+ |
| InChIKey | LBCMWLTZVJZOJW-BGYRXZFFSA-N |
| XLogP | 3.84 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.75 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|