C19H18 — CID 169059563
10-propan-2-yl-4,10c-dihydropyrene (PubChem CID 169059563) has the molecular formula C19H18 and a molecular weight of 246.35 g/mol. Its IUPAC name is 10-propan-2-yl-4,10c-dihydropyrene.
| Compound Name | 10-propan-2-yl-4,10c-dihydropyrene |
|---|---|
| PubChem CID | 169059563 |
| Molecular Formula | C19H18 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 10-propan-2-yl-4,10c-dihydropyrene |
| SMILES | CC(C)C1=CC2=CC=CC3=CCc4cccc1c4C23 |
| InChI | InChI=1S/C19H18/c1-12(2)17-11-15-7-3-5-13-9-10-14-6-4-8-16(17)19(14)18(13)15/h3-9,11-12,18H,10H2,1-2H3 |
| InChIKey | KKSIJFRESITVPN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |