C30H33N7O — CID 169060351
11-benzyl-7-[[4-(4-cyclopentyltriazol-1-yl)phenyl]methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5-dien-8-one (PubChem CID 169060351) has the molecular formula C30H33N7O and a molecular weight of 507.64 g/mol. Its IUPAC name is 11-benzyl-7-[[4-(4-cyclopentyltriazol-1-yl)phenyl]methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5-dien-8-one.
| Compound Name | 11-benzyl-7-[[4-(4-cyclopentyltriazol-1-yl)phenyl]methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5-dien-8-one |
|---|---|
| PubChem CID | 169060351 |
| Molecular Formula | C30H33N7O |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | 11-benzyl-7-[[4-(4-cyclopentyltriazol-1-yl)phenyl]methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5-dien-8-one |
| SMILES | O=C1C2=C(CCN(Cc3ccccc3)C2)N2CCN=C2N1Cc1ccc(-n2cc(C3CCCC3)nn2)cc1 |
| InChI | InChI=1S/C30H33N7O/c38-29-26-20-34(18-22-6-2-1-3-7-22)16-14-28(26)35-17-15-31-30(35)36(29)19-23-10-12-25(13-11-23)37-21-27(32-33-37)24-8-4-5-9-24/h1-3,6-7,10-13,21,24H,4-5,8-9,14-20H2 |
| InChIKey | DGKFFUSETLEHKT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 69.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |