C30H26ClF3N2O5 — CID 169068379
1-[(2R,4S,5R)-5-(chloromethyl)-5-(hydroxymethyl)-4-trityloxyoxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 169068379) has the molecular formula C30H26ClF3N2O5 and a molecular weight of 586.99 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-5-(chloromethyl)-5-(hydroxymethyl)-4-trityloxyoxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-5-(chloromethyl)-5-(hydroxymethyl)-4-trityloxyoxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 169068379 |
| Molecular Formula | C30H26ClF3N2O5 |
| Molecular Weight | 586.99 g/mol |
| Exact Mass | 586.15 |
| IUPAC Name | 1-[(2R,4S,5R)-5-(chloromethyl)-5-(hydroxymethyl)-4-trityloxyoxolan-2-yl]-5-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@H]2C[C@H](OC(c3ccccc3)(c3ccccc3)c3ccccc3)[C@](CO)(CCl)O2)cc1C(F)(F)F |
| InChI | InChI=1S/C30H26ClF3N2O5/c31-18-28(19-37)24(16-25(41-28)36-17-23(30(32,33)34)26(38)35-27(36)39)40-29(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-15,17,24-25,37H,16,18-19H2,(H,35,38,39)/t24-,25+,28+/m0/s1 |
| InChIKey | YUQBWTLYOXGROU-BXTSTYNKSA-N |
| XLogP | 4.82 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.99 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|