C29H29FN2O4 — CID 175934697
[(3S,5R)-5-(5-fluoro-2H-pyrimidin-1-yl)-2-(hydroxymethyl)-3-trityloxyoxolan-2-yl]methanol (PubChem CID 175934697) has the molecular formula C29H29FN2O4 and a molecular weight of 488.56 g/mol. Its IUPAC name is [(3S,5R)-5-(5-fluoro-2H-pyrimidin-1-yl)-2-(hydroxymethyl)-3-trityloxyoxolan-2-yl]methanol.
| Compound Name | [(3S,5R)-5-(5-fluoro-2H-pyrimidin-1-yl)-2-(hydroxymethyl)-3-trityloxyoxolan-2-yl]methanol |
|---|---|
| PubChem CID | 175934697 |
| Molecular Formula | C29H29FN2O4 |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | [(3S,5R)-5-(5-fluoro-2H-pyrimidin-1-yl)-2-(hydroxymethyl)-3-trityloxyoxolan-2-yl]methanol |
| SMILES | OCC1(CO)O[C@@H](N2C=C(F)C=NC2)C[C@@H]1OC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H29FN2O4/c30-25-17-31-21-32(18-25)27-16-26(28(19-33,20-34)36-27)35-29(22-10-4-1-5-11-22,23-12-6-2-7-13-23)24-14-8-3-9-15-24/h1-15,17-18,26-27,33-34H,16,19-21H2/t26-,27+/m0/s1 |
| InChIKey | SUFMLLMXADGEPZ-RRPNLBNLSA-N |
| XLogP | 3.99 |
| TPSA | 74.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|