C31H29ClN2O5 — CID 169068420
(1R,10R,11S)-10-(chloromethyl)-11-[(4-methoxyphenyl)-diphenylmethoxy]-4-methyl-8,13-dioxa-2,6-diazatricyclo[8.2.1.02,7]trideca-3,6-dien-5-one (PubChem CID 169068420) has the molecular formula C31H29ClN2O5 and a molecular weight of 545.04 g/mol. Its IUPAC name is (1R,10R,11S)-10-(chloromethyl)-11-[(4-methoxyphenyl)-diphenylmethoxy]-4-methyl-8,13-dioxa-2,6-diazatricyclo[8.2.1.02,7]trideca-3,6-dien-5-one.
| Compound Name | (1R,10R,11S)-10-(chloromethyl)-11-[(4-methoxyphenyl)-diphenylmethoxy]-4-methyl-8,13-dioxa-2,6-diazatricyclo[8.2.1.02,7]trideca-3,6-dien-5-one |
|---|---|
| PubChem CID | 169068420 |
| Molecular Formula | C31H29ClN2O5 |
| Molecular Weight | 545.04 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | (1R,10R,11S)-10-(chloromethyl)-11-[(4-methoxyphenyl)-diphenylmethoxy]-4-methyl-8,13-dioxa-2,6-diazatricyclo[8.2.1.02,7]trideca-3,6-dien-5-one |
| SMILES | COc1ccc(C(O[C@H]2C[C@H]3O[C@]2(CCl)COc2nc(=O)c(C)cn23)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H29ClN2O5/c1-21-18-34-27-17-26(30(19-32,39-27)20-37-29(34)33-28(21)35)38-31(22-9-5-3-6-10-22,23-11-7-4-8-12-23)24-13-15-25(36-2)16-14-24/h3-16,18,26-27H,17,19-20H2,1-2H3/t26-,27+,30+/m0/s1 |
| InChIKey | KCVMZENXJZQBQN-PVTPYKNESA-N |
| XLogP | 5.23 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.04 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|