C30H30ClN3O6 — CID 169068338
1-[(2R,4S,5R)-5-(chloromethyl)-5-(hydroxymethyl)-4-[(4-methoxyphenyl)-diphenylmethoxy]oxolan-2-yl]-4-(hydroxyamino)pyrimidin-2-one (PubChem CID 169068338) has the molecular formula C30H30ClN3O6 and a molecular weight of 564.04 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-5-(chloromethyl)-5-(hydroxymethyl)-4-[(4-methoxyphenyl)-diphenylmethoxy]oxolan-2-yl]-4-(hydroxyamino)pyrimidin-2-one.
| Compound Name | 1-[(2R,4S,5R)-5-(chloromethyl)-5-(hydroxymethyl)-4-[(4-methoxyphenyl)-diphenylmethoxy]oxolan-2-yl]-4-(hydroxyamino)pyrimidin-2-one |
|---|---|
| PubChem CID | 169068338 |
| Molecular Formula | C30H30ClN3O6 |
| Molecular Weight | 564.04 g/mol |
| Exact Mass | 563.18 |
| IUPAC Name | 1-[(2R,4S,5R)-5-(chloromethyl)-5-(hydroxymethyl)-4-[(4-methoxyphenyl)-diphenylmethoxy]oxolan-2-yl]-4-(hydroxyamino)pyrimidin-2-one |
| SMILES | COc1ccc(C(O[C@H]2C[C@H](n3ccc(NO)nc3=O)O[C@@]2(CO)CCl)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H30ClN3O6/c1-38-24-14-12-23(13-15-24)30(21-8-4-2-5-9-21,22-10-6-3-7-11-22)39-25-18-27(40-29(25,19-31)20-35)34-17-16-26(33-37)32-28(34)36/h2-17,25,27,35,37H,18-20H2,1H3,(H,32,33,36)/t25-,27+,29+/m0/s1 |
| InChIKey | JXVIXGPLPMMGDJ-BOSLPAGOSA-N |
| XLogP | 4.32 |
| TPSA | 115.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.04 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|