C54H52Br2O2 — CID 169069310
2-[4-(7-bromoheptan-2-yl)phenyl]-3-[4-[2-[4-(7-bromoheptan-2-yl)phenyl]-3-oxo-5-phenylcyclopenta-1,4-dien-1-yl]phenyl]-4-phenylcyclopenta-2,4-dien-1-one (PubChem CID 169069310) has the molecular formula C54H52Br2O2 and a molecular weight of 892.82 g/mol. Its IUPAC name is 2-[4-(7-bromoheptan-2-yl)phenyl]-3-[4-[2-[4-(7-bromoheptan-2-yl)phenyl]-3-oxo-5-phenylcyclopenta-1,4-dien-1-yl]phenyl]-4-phenylcyclopenta-2,4-dien-1-one.
| Compound Name | 2-[4-(7-bromoheptan-2-yl)phenyl]-3-[4-[2-[4-(7-bromoheptan-2-yl)phenyl]-3-oxo-5-phenylcyclopenta-1,4-dien-1-yl]phenyl]-4-phenylcyclopenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 169069310 |
| Molecular Formula | C54H52Br2O2 |
| Molecular Weight | 892.82 g/mol |
| Exact Mass | 890.23 |
| IUPAC Name | 2-[4-(7-bromoheptan-2-yl)phenyl]-3-[4-[2-[4-(7-bromoheptan-2-yl)phenyl]-3-oxo-5-phenylcyclopenta-1,4-dien-1-yl]phenyl]-4-phenylcyclopenta-2,4-dien-1-one |
| SMILES | CC(CCCCCBr)c1ccc(C2=C(c3ccc(C4=C(c5ccc(C(C)CCCCCBr)cc5)C(=O)C=C4c4ccccc4)cc3)C(c3ccccc3)=CC2=O)cc1 |
| InChI | InChI=1S/C54H52Br2O2/c1-37(15-7-5-13-33-55)39-21-25-45(26-22-39)53-49(57)35-47(41-17-9-3-10-18-41)51(53)43-29-31-44(32-30-43)52-48(42-19-11-4-12-20-42)36-50(58)54(52)46-27-23-40(24-28-46)38(2)16-8-6-14-34-56/h3-4,9-12,17-32,35-38H,5-8,13-16,33-34H2,1-2H3 |
| InChIKey | HESKOGCTDSVEML-UHFFFAOYSA-N |
| XLogP | 14.96 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.82 |
| LogP ≤ 5 | 14.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|