C44H28N2 — CID 169071299
1-[2-(10-fluoranthen-3-ylanthracen-9-yl)phenyl]-2-(trideuteriomethyl)benzimidazole (PubChem CID 169071299) has the molecular formula C44H28N2 and a molecular weight of 587.74 g/mol. Its IUPAC name is 1-[2-(10-fluoranthen-3-ylanthracen-9-yl)phenyl]-2-(trideuteriomethyl)benzimidazole.
| Compound Name | 1-[2-(10-fluoranthen-3-ylanthracen-9-yl)phenyl]-2-(trideuteriomethyl)benzimidazole |
|---|---|
| PubChem CID | 169071299 |
| Molecular Formula | C44H28N2 |
| Molecular Weight | 587.74 g/mol |
| Exact Mass | 587.24 |
| IUPAC Name | 1-[2-(10-fluoranthen-3-ylanthracen-9-yl)phenyl]-2-(trideuteriomethyl)benzimidazole |
| SMILES | [2H]C([2H])([2H])c1nc2ccccc2n1-c1ccccc1-c1c2ccccc2c(-c2ccc3c4c(cccc24)-c2ccccc2-3)c2ccccc12 |
| InChI | InChI=1S/C44H28N2/c1-27-45-39-22-9-11-24-41(39)46(27)40-23-10-8-19-38(40)44-33-17-6-4-15-31(33)43(32-16-5-7-18-34(32)44)37-26-25-36-29-14-3-2-13-28(29)30-20-12-21-35(37)42(30)36/h2-26H,1H3/i1D3 |
| InChIKey | MPUQRPGOJYLNJS-FIBGUPNXSA-N |
| XLogP | 11.77 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.74 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|