C30H32ClN7O2 — CID 169074706
tert-butyl 4-[3-[[7-(2-chlorophenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-12-ylidene]amino]phenyl]piperazine-1-carboxylate (PubChem CID 169074706) has the molecular formula C30H32ClN7O2 and a molecular weight of 558.09 g/mol. Its IUPAC name is tert-butyl 4-[3-[[7-(2-chlorophenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-12-ylidene]amino]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[[7-(2-chlorophenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-12-ylidene]amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 169074706 |
| Molecular Formula | C30H32ClN7O2 |
| Molecular Weight | 558.09 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | tert-butyl 4-[3-[[7-(2-chlorophenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-12-ylidene]amino]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cccc(/N=c3\ncc4cc(-c5ccccc5Cl)c5n(c-4n3)CCN5)c2)CC1 |
| InChI | InChI=1S/C30H32ClN7O2/c1-30(2,3)40-29(39)37-15-13-36(14-16-37)22-8-6-7-21(18-22)34-28-33-19-20-17-24(23-9-4-5-10-25(23)31)27-32-11-12-38(27)26(20)35-28/h4-10,17-19,32H,11-16H2,1-3H3/b34-28+ |
| InChIKey | HDWPTRWQAWIQLT-CDSHQWRTSA-N |
| XLogP | 5.42 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.09 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |