C21H21F4N7O — CID 169074923
1-[2-fluoro-4-methyl-5-(12-methylimino-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-7-yl)phenyl]-3-(3,3,3-trifluoropropyl)urea (PubChem CID 169074923) has the molecular formula C21H21F4N7O and a molecular weight of 463.44 g/mol. Its IUPAC name is 1-[2-fluoro-4-methyl-5-(12-methylimino-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-7-yl)phenyl]-3-(3,3,3-trifluoropropyl)urea.
| Compound Name | 1-[2-fluoro-4-methyl-5-(12-methylimino-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-7-yl)phenyl]-3-(3,3,3-trifluoropropyl)urea |
|---|---|
| PubChem CID | 169074923 |
| Molecular Formula | C21H21F4N7O |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 1-[2-fluoro-4-methyl-5-(12-methylimino-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-7-yl)phenyl]-3-(3,3,3-trifluoropropyl)urea |
| SMILES | C/N=c1\ncc2cc(-c3cc(NC(=O)NCCC(F)(F)F)c(F)cc3C)c3n(c-2n1)CCN3 |
| InChI | InChI=1S/C21H21F4N7O/c1-11-7-15(22)16(30-20(33)28-4-3-21(23,24)25)9-13(11)14-8-12-10-29-19(26-2)31-17(12)32-6-5-27-18(14)32/h7-10,27H,3-6H2,1-2H3,(H2,28,30,33)/b26-19+ |
| InChIKey | JRNVAUMMONJGND-LGUFXXKBSA-N |
| XLogP | 3.53 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |