C28H25F2N7O2 — CID 169075157
1-N'-[2-fluoro-4-methyl-5-(12-methylimino-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-7-yl)phenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 169075157) has the molecular formula C28H25F2N7O2 and a molecular weight of 529.55 g/mol. Its IUPAC name is 1-N'-[2-fluoro-4-methyl-5-(12-methylimino-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-7-yl)phenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[2-fluoro-4-methyl-5-(12-methylimino-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-7-yl)phenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 169075157 |
| Molecular Formula | C28H25F2N7O2 |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | 1-N'-[2-fluoro-4-methyl-5-(12-methylimino-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-7-yl)phenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | C/N=c1\ncc2cc(-c3cc(N(C(=O)C4(C(N)=O)CC4)c4ccc(F)cc4)c(F)cc3C)c3n(c-2n1)CCN3 |
| InChI | InChI=1S/C28H25F2N7O2/c1-15-11-21(30)22(37(18-5-3-17(29)4-6-18)26(39)28(7-8-28)25(31)38)13-19(15)20-12-16-14-34-27(32-2)35-23(16)36-10-9-33-24(20)36/h3-6,11-14,33H,7-10H2,1-2H3,(H2,31,38)/b32-27+ |
| InChIKey | IERBLJOFFXLQJZ-QVAGMWBUSA-N |
| XLogP | 3.52 |
| TPSA | 118.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|