C16H15FN6 — CID 169075199
2-fluoro-5-(12-methylimino-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-7-yl)aniline (PubChem CID 169075199) has the molecular formula C16H15FN6 and a molecular weight of 310.34 g/mol. Its IUPAC name is 2-fluoro-5-(12-methylimino-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-7-yl)aniline.
| Compound Name | 2-fluoro-5-(12-methylimino-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-7-yl)aniline |
|---|---|
| PubChem CID | 169075199 |
| Molecular Formula | C16H15FN6 |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2-fluoro-5-(12-methylimino-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-7-yl)aniline |
| SMILES | C/N=c1\ncc2cc(-c3ccc(F)c(N)c3)c3n(c-2n1)CCN3 |
| InChI | InChI=1S/C16H15FN6/c1-19-16-21-8-10-6-11(9-2-3-12(17)13(18)7-9)15-20-4-5-23(15)14(10)22-16/h2-3,6-8,20H,4-5,18H2,1H3/b19-16+ |
| InChIKey | KKRKCRCKRBSGAY-KNTRCKAVSA-N |
| XLogP | 1.73 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|