C28H33N7 — CID 170150036
7-(2-methylcyclohexa-1,5-dien-1-yl)-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-12-imine (PubChem CID 170150036) has the molecular formula C28H33N7 and a molecular weight of 467.62 g/mol. Its IUPAC name is 7-(2-methylcyclohexa-1,5-dien-1-yl)-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-12-imine.
| Compound Name | 7-(2-methylcyclohexa-1,5-dien-1-yl)-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-12-imine |
|---|---|
| PubChem CID | 170150036 |
| Molecular Formula | C28H33N7 |
| Molecular Weight | 467.62 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | 7-(2-methylcyclohexa-1,5-dien-1-yl)-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-12-imine |
| SMILES | CC1=C(c2cc3cn/c(=N\c4ccc(N5CCN(C)CC5)cc4C)nc-3n3c2NCC3)C=CCC1 |
| InChI | InChI=1S/C28H33N7/c1-19-6-4-5-7-23(19)24-17-21-18-30-28(32-26(21)35-11-10-29-27(24)35)31-25-9-8-22(16-20(25)2)34-14-12-33(3)13-15-34/h5,7-9,16-18,29H,4,6,10-15H2,1-3H3/b31-28+ |
| InChIKey | SEZSFYKYKULLRM-CCFHIKDMSA-N |
| XLogP | 4.22 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.62 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|