C18H17FN6O — CID 169075167
2-fluoro-5-[12-(oxetan-3-ylimino)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-7-yl]aniline (PubChem CID 169075167) has the molecular formula C18H17FN6O and a molecular weight of 352.37 g/mol. Its IUPAC name is 2-fluoro-5-[12-(oxetan-3-ylimino)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-7-yl]aniline.
| Compound Name | 2-fluoro-5-[12-(oxetan-3-ylimino)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-7-yl]aniline |
|---|---|
| PubChem CID | 169075167 |
| Molecular Formula | C18H17FN6O |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2-fluoro-5-[12-(oxetan-3-ylimino)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-7-yl]aniline |
| SMILES | Nc1cc(-c2cc3cn/c(=N\C4COC4)nc-3n3c2NCC3)ccc1F |
| InChI | InChI=1S/C18H17FN6O/c19-14-2-1-10(6-15(14)20)13-5-11-7-22-18(23-12-8-26-9-12)24-16(11)25-4-3-21-17(13)25/h1-2,5-7,12,21H,3-4,8-9,20H2/b23-18+ |
| InChIKey | NXWKQYXCLRKIOB-PTGBLXJZSA-N |
| XLogP | 1.50 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|