C12H9BrN6O — CID 163527695
7-bromo-N-(1,2-oxazol-3-yl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-12-imine (PubChem CID 163527695) has the molecular formula C12H9BrN6O and a molecular weight of 333.15 g/mol. Its IUPAC name is 7-bromo-N-(1,2-oxazol-3-yl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-12-imine.
| Compound Name | 7-bromo-N-(1,2-oxazol-3-yl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-12-imine |
|---|---|
| PubChem CID | 163527695 |
| Molecular Formula | C12H9BrN6O |
| Molecular Weight | 333.15 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | 7-bromo-N-(1,2-oxazol-3-yl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-12-imine |
| SMILES | Brc1cc2cn/c(=N\c3ccon3)nc-2n2c1NCC2 |
| InChI | InChI=1S/C12H9BrN6O/c13-8-5-7-6-15-12(16-9-1-4-20-18-9)17-10(7)19-3-2-14-11(8)19/h1,4-6,14H,2-3H2/b16-12+ |
| InChIKey | RYLPTTIHFVRKPE-FOWTUZBSSA-N |
| XLogP | 1.79 |
| TPSA | 81.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.15 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |