C19H16ClN7 — CID 169075047
(Z)-7-(2-chlorophenyl)-N-(2-methylpyrazol-3-yl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-12-imine (PubChem CID 169075047) has the molecular formula C19H16ClN7 and a molecular weight of 377.84 g/mol. Its IUPAC name is (Z)-7-(2-chlorophenyl)-N-(2-methylpyrazol-3-yl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-12-imine.
| Compound Name | (Z)-7-(2-chlorophenyl)-N-(2-methylpyrazol-3-yl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-12-imine |
|---|---|
| PubChem CID | 169075047 |
| Molecular Formula | C19H16ClN7 |
| Molecular Weight | 377.84 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | (Z)-7-(2-chlorophenyl)-N-(2-methylpyrazol-3-yl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-12-imine |
| SMILES | Cn1nccc1/N=c1/ncc2cc(-c3ccccc3Cl)c3n(c-2n1)CCN3 |
| InChI | InChI=1S/C19H16ClN7/c1-26-16(6-7-23-26)24-19-22-11-12-10-14(13-4-2-3-5-15(13)20)18-21-8-9-27(18)17(12)25-19/h2-7,10-11,21H,8-9H2,1H3/b24-19- |
| InChIKey | HMAFNAAJZWPCBN-CLCOLTQESA-N |
| XLogP | 3.09 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.84 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |