C23H22F2N6O2 — CID 169074637
1-[3-[[7-(2,4-difluorophenoxy)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-12-ylidene]amino]piperidin-1-yl]prop-2-en-1-one (PubChem CID 169074637) has the molecular formula C23H22F2N6O2 and a molecular weight of 452.47 g/mol. Its IUPAC name is 1-[3-[[7-(2,4-difluorophenoxy)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-12-ylidene]amino]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[[7-(2,4-difluorophenoxy)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-12-ylidene]amino]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 169074637 |
| Molecular Formula | C23H22F2N6O2 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 1-[3-[[7-(2,4-difluorophenoxy)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraen-12-ylidene]amino]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC(/N=c2\ncc3cc(Oc4ccc(F)cc4F)c4n(c-3n2)CCN4)C1 |
| InChI | InChI=1S/C23H22F2N6O2/c1-2-20(32)30-8-3-4-16(13-30)28-23-27-12-14-10-19(22-26-7-9-31(22)21(14)29-23)33-18-6-5-15(24)11-17(18)25/h2,5-6,10-12,16,26H,1,3-4,7-9,13H2/b28-23+ |
| InChIKey | ZYZRBQMHOAHKBV-WEMUOSSPSA-N |
| XLogP | 2.96 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|