C24H17F2N6O4S- — CID 169220773
7-(2,4-difluorophenoxy)-12-[4-[3-oxo-3-(sulfinatoamino)prop-1-enyl]phenyl]imino-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraene (PubChem CID 169220773) has the molecular formula C24H17F2N6O4S- and a molecular weight of 523.50 g/mol. Its IUPAC name is 7-(2,4-difluorophenoxy)-12-[4-[3-oxo-3-(sulfinatoamino)prop-1-enyl]phenyl]imino-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraene.
| Compound Name | 7-(2,4-difluorophenoxy)-12-[4-[3-oxo-3-(sulfinatoamino)prop-1-enyl]phenyl]imino-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraene |
|---|---|
| PubChem CID | 169220773 |
| Molecular Formula | C24H17F2N6O4S- |
| Molecular Weight | 523.50 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | 7-(2,4-difluorophenoxy)-12-[4-[3-oxo-3-(sulfinatoamino)prop-1-enyl]phenyl]imino-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),6,8,10-tetraene |
| SMILES | O=C(C=Cc1ccc(/N=c2\ncc3cc(Oc4ccc(F)cc4F)c4n(c-3n2)CCN4)cc1)NS(=O)[O-] |
| InChI | InChI=1S/C24H18F2N6O4S/c25-16-4-7-19(18(26)12-16)36-20-11-15-13-28-24(30-22(15)32-10-9-27-23(20)32)29-17-5-1-14(2-6-17)3-8-21(33)31-37(34)35/h1-8,11-13,27H,9-10H2,(H,31,33)(H,34,35)/p-1/b8-3?,29-24+ |
| InChIKey | PCAMOTALDONFCL-ACOOORHMSA-M |
| XLogP | 3.03 |
| TPSA | 133.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|