C19H14F2N2O4 — CID 90577771
(E)-N-[4-(2,4-difluorophenoxy)but-2-ynyl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 90577771) has the molecular formula C19H14F2N2O4 and a molecular weight of 372.33 g/mol. Its IUPAC name is (E)-N-[4-(2,4-difluorophenoxy)but-2-ynyl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(2,4-difluorophenoxy)but-2-ynyl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 90577771 |
| Molecular Formula | C19H14F2N2O4 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | (E)-N-[4-(2,4-difluorophenoxy)but-2-ynyl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)NCC#CCOc1ccc(F)cc1F |
| InChI | InChI=1S/C19H14F2N2O4/c20-15-6-9-18(17(21)13-15)27-12-2-1-11-22-19(24)10-5-14-3-7-16(8-4-14)23(25)26/h3-10,13H,11-12H2,(H,22,24)/b10-5+ |
| InChIKey | YWXZQYLJPYNHLV-BJMVGYQFSA-N |
| XLogP | 3.08 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|