C9H9F3N2O4 — CID 169084304
ethyl 2-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]acetate (PubChem CID 169084304) has the molecular formula C9H9F3N2O4 and a molecular weight of 266.17 g/mol. Its IUPAC name is ethyl 2-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]acetate.
| Compound Name | ethyl 2-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]acetate |
|---|---|
| PubChem CID | 169084304 |
| Molecular Formula | C9H9F3N2O4 |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | ethyl 2-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]acetate |
| SMILES | CCOC(=O)Cn1cc(C(F)(F)F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H9F3N2O4/c1-2-18-6(15)4-14-3-5(9(10,11)12)7(16)13-8(14)17/h3H,2,4H2,1H3,(H,13,16,17) |
| InChIKey | PMSGGMIJMLCGQQ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |