C11H6ClN3S — CID 169085626
5-(2-chloropyrimidin-4-yl)-1,3-benzothiazole (PubChem CID 169085626) has the molecular formula C11H6ClN3S and a molecular weight of 247.71 g/mol. Its IUPAC name is 5-(2-chloropyrimidin-4-yl)-1,3-benzothiazole.
| Compound Name | 5-(2-chloropyrimidin-4-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 169085626 |
| Molecular Formula | C11H6ClN3S |
| Molecular Weight | 247.71 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | 5-(2-chloropyrimidin-4-yl)-1,3-benzothiazole |
| SMILES | Clc1nccc(-c2ccc3scnc3c2)n1 |
| InChI | InChI=1S/C11H6ClN3S/c12-11-13-4-3-8(15-11)7-1-2-10-9(5-7)14-6-16-10/h1-6H |
| InChIKey | SOPLBWZNMXOICO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.71 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |