C19H34O3 — CID 169085695
[2-[(E)-3,5-dimethylhex-3-en-2-yl]oxy-2-methylpropyl] cyclohexanecarboxylate (PubChem CID 169085695) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is [2-[(E)-3,5-dimethylhex-3-en-2-yl]oxy-2-methylpropyl] cyclohexanecarboxylate.
| Compound Name | [2-[(E)-3,5-dimethylhex-3-en-2-yl]oxy-2-methylpropyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 169085695 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | [2-[(E)-3,5-dimethylhex-3-en-2-yl]oxy-2-methylpropyl] cyclohexanecarboxylate |
| SMILES | C/C(=C\C(C)C)C(C)OC(C)(C)COC(=O)C1CCCCC1 |
| InChI | InChI=1S/C19H34O3/c1-14(2)12-15(3)16(4)22-19(5,6)13-21-18(20)17-10-8-7-9-11-17/h12,14,16-17H,7-11,13H2,1-6H3/b15-12+ |
| InChIKey | KQJXRXPWSUXZFS-NTCAYCPXSA-N |
| XLogP | 4.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|