C12H25NO5Si — CID 169085960
(2S)-2-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-trimethylsilylbutanoic acid (PubChem CID 169085960) has the molecular formula C12H25NO5Si and a molecular weight of 291.42 g/mol. Its IUPAC name is (2S)-2-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-trimethylsilylbutanoic acid.
| Compound Name | (2S)-2-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-trimethylsilylbutanoic acid |
|---|---|
| PubChem CID | 169085960 |
| Molecular Formula | C12H25NO5Si |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | (2S)-2-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-trimethylsilylbutanoic acid |
| SMILES | CC(C)(C)OC(=O)NCC[C@@](O)(C(=O)O)[Si](C)(C)C |
| InChI | InChI=1S/C12H25NO5Si/c1-11(2,3)18-10(16)13-8-7-12(17,9(14)15)19(4,5)6/h17H,7-8H2,1-6H3,(H,13,16)(H,14,15)/t12-/m0/s1 |
| InChIKey | FGLZEAILWRUDTD-LBPRGKRZSA-N |
| XLogP | 1.59 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|