C16H34N2O4Si — CID 174892013
ethyl (2R)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-trimethylsilylhexanoate (PubChem CID 174892013) has the molecular formula C16H34N2O4Si and a molecular weight of 346.54 g/mol. Its IUPAC name is ethyl (2R)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-trimethylsilylhexanoate.
| Compound Name | ethyl (2R)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-trimethylsilylhexanoate |
|---|---|
| PubChem CID | 174892013 |
| Molecular Formula | C16H34N2O4Si |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | ethyl (2R)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-trimethylsilylhexanoate |
| SMILES | CCOC(=O)[C@@](N)(CCCCNC(=O)OC(C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C16H34N2O4Si/c1-8-21-13(19)16(17,23(5,6)7)11-9-10-12-18-14(20)22-15(2,3)4/h8-12,17H2,1-7H3,(H,18,20)/t16-/m1/s1 |
| InChIKey | NMOSALFNBUVVCF-MRXNPFEDSA-N |
| XLogP | 2.82 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|