C28H35N9O2 — CID 169086892
2-[6-[[5-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-2-pyridinyl]amino]pyrimidin-4-yl]imino-1-hydroxy-4-methylspiro[6H-pyrrolo[3,4-b]pyridine-7,1'-cyclohexane]-5-one (PubChem CID 169086892) has the molecular formula C28H35N9O2 and a molecular weight of 529.65 g/mol. Its IUPAC name is 2-[6-[[5-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-2-pyridinyl]amino]pyrimidin-4-yl]imino-1-hydroxy-4-methylspiro[6H-pyrrolo[3,4-b]pyridine-7,1'-cyclohexane]-5-one.
| Compound Name | 2-[6-[[5-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-2-pyridinyl]amino]pyrimidin-4-yl]imino-1-hydroxy-4-methylspiro[6H-pyrrolo[3,4-b]pyridine-7,1'-cyclohexane]-5-one |
|---|---|
| PubChem CID | 169086892 |
| Molecular Formula | C28H35N9O2 |
| Molecular Weight | 529.65 g/mol |
| Exact Mass | 529.29 |
| IUPAC Name | 2-[6-[[5-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-2-pyridinyl]amino]pyrimidin-4-yl]imino-1-hydroxy-4-methylspiro[6H-pyrrolo[3,4-b]pyridine-7,1'-cyclohexane]-5-one |
| SMILES | Cc1c/c(=N\c2cc(Nc3ccc(N4C[C@@H](C)N[C@@H](C)C4)cn3)ncn2)n(O)c2c1C(=O)NC21CCCCC1 |
| InChI | InChI=1S/C28H35N9O2/c1-17-11-24(37(39)26-25(17)27(38)35-28(26)9-5-4-6-10-28)34-23-12-22(30-16-31-23)33-21-8-7-20(13-29-21)36-14-18(2)32-19(3)15-36/h7-8,11-13,16,18-19,32,39H,4-6,9-10,14-15H2,1-3H3,(H,35,38)(H,29,30,31,33)/b34-24+/t18-,19+ |
| InChIKey | UMDSYWLUVLAFPA-RGALSMHNSA-N |
| XLogP | 3.28 |
| TPSA | 132.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.65 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|