C18H19N7O2 — CID 163547605
1-hydroxy-4-methyl-2-(7H-purin-6-ylimino)spiro[6H-pyrrolo[3,4-b]pyridine-7,1'-cyclohexane]-5-one (PubChem CID 163547605) has the molecular formula C18H19N7O2 and a molecular weight of 365.40 g/mol. Its IUPAC name is 1-hydroxy-4-methyl-2-(7H-purin-6-ylimino)spiro[6H-pyrrolo[3,4-b]pyridine-7,1'-cyclohexane]-5-one.
| Compound Name | 1-hydroxy-4-methyl-2-(7H-purin-6-ylimino)spiro[6H-pyrrolo[3,4-b]pyridine-7,1'-cyclohexane]-5-one |
|---|---|
| PubChem CID | 163547605 |
| Molecular Formula | C18H19N7O2 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 1-hydroxy-4-methyl-2-(7H-purin-6-ylimino)spiro[6H-pyrrolo[3,4-b]pyridine-7,1'-cyclohexane]-5-one |
| SMILES | Cc1c/c(=N\c2ncnc3nc[nH]c23)n(O)c2c1C(=O)NC21CCCCC1 |
| InChI | InChI=1S/C18H19N7O2/c1-10-7-11(23-16-13-15(20-8-19-13)21-9-22-16)25(27)14-12(10)17(26)24-18(14)5-3-2-4-6-18/h7-9,27H,2-6H2,1H3,(H,24,26)(H,19,20,21,22)/b23-11+ |
| InChIKey | CVANDXQQNPUXBC-FOKLQQMPSA-N |
| XLogP | 1.84 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|