C13H12N6 — CID 91897077
(4-methylphenyl)methyl-(7H-purin-6-yl)diazene (PubChem CID 91897077) has the molecular formula C13H12N6 and a molecular weight of 252.28 g/mol. Its IUPAC name is (4-methylphenyl)methyl-(7H-purin-6-yl)diazene.
| Compound Name | (4-methylphenyl)methyl-(7H-purin-6-yl)diazene |
|---|---|
| PubChem CID | 91897077 |
| Molecular Formula | C13H12N6 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | (4-methylphenyl)methyl-(7H-purin-6-yl)diazene |
| SMILES | Cc1ccc(C/N=N/c2ncnc3nc[nH]c23)cc1 |
| InChI | InChI=1S/C13H12N6/c1-9-2-4-10(5-3-9)6-18-19-13-11-12(15-7-14-11)16-8-17-13/h2-5,7-8H,6H2,1H3,(H,14,15,16,17)/b19-18+ |
| InChIKey | QGSIARNBIQLLGD-VHEBQXMUSA-N |
| XLogP | 2.95 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|