C33H39N3O2 — CID 169098756
2-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-(2,4,4-trimethylpentan-2-yloxy)phenol (PubChem CID 169098756) has the molecular formula C33H39N3O2 and a molecular weight of 509.69 g/mol. Its IUPAC name is 2-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-(2,4,4-trimethylpentan-2-yloxy)phenol.
| Compound Name | 2-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-(2,4,4-trimethylpentan-2-yloxy)phenol |
|---|---|
| PubChem CID | 169098756 |
| Molecular Formula | C33H39N3O2 |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | 2-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-(2,4,4-trimethylpentan-2-yloxy)phenol |
| SMILES | Cc1ccc(-c2nc(-c3ccc(C)cc3C)nc(-c3ccc(OC(C)(C)CC(C)(C)C)cc3O)n2)c(C)c1 |
| InChI | InChI=1S/C33H39N3O2/c1-20-10-13-25(22(3)16-20)29-34-30(26-14-11-21(2)17-23(26)4)36-31(35-29)27-15-12-24(18-28(27)37)38-33(8,9)19-32(5,6)7/h10-18,37H,19H2,1-9H3 |
| InChIKey | LZCPLJXGZYZREF-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |