C30H29N3O3U — CID 163627714
2-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-ethoxyphenol;prop-2-en-1-one;uranium(2+) (PubChem CID 163627714) has the molecular formula C30H29N3O3U and a molecular weight of 717.61 g/mol. Its IUPAC name is 2-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-ethoxyphenol;prop-2-en-1-one;uranium(2+).
| Compound Name | 2-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-ethoxyphenol;prop-2-en-1-one;uranium(2+) |
|---|---|
| PubChem CID | 163627714 |
| Molecular Formula | C30H29N3O3U |
| Molecular Weight | 717.61 g/mol |
| Exact Mass | 717.27 |
| IUPAC Name | 2-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-ethoxyphenol;prop-2-en-1-one;uranium(2+) |
| SMILES | C=C[C-]=O.[CH2-]COc1ccc(-c2nc(-c3ccc(C)cc3C)nc(-c3ccc(C)cc3C)n2)c(O)c1.[U+2] |
| InChI | InChI=1S/C27H26N3O2.C3H3O.U/c1-6-32-20-9-12-23(24(31)15-20)27-29-25(21-10-7-16(2)13-18(21)4)28-26(30-27)22-11-8-17(3)14-19(22)5;1-2-3-4;/h7-15,31H,1,6H2,2-5H3;2H,1H2;/q2*-1;+2 |
| InChIKey | PPDLTGMMLQETIA-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 85.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.61 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|