C33H34N4O5 — CID 135708091
2-[[2-[4-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]acetyl]-methylamino]ethyl prop-2-enoate (PubChem CID 135708091) has the molecular formula C33H34N4O5 and a molecular weight of 566.66 g/mol. Its IUPAC name is 2-[[2-[4-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]acetyl]-methylamino]ethyl prop-2-enoate.
| Compound Name | 2-[[2-[4-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]acetyl]-methylamino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 135708091 |
| Molecular Formula | C33H34N4O5 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | 2-[[2-[4-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]acetyl]-methylamino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCN(C)C(=O)COc1ccc(-c2nc(-c3ccc(C)cc3C)nc(-c3ccc(C)cc3C)n2)c(O)c1 |
| InChI | InChI=1S/C33H34N4O5/c1-7-30(40)41-15-14-37(6)29(39)19-42-24-10-13-27(28(38)18-24)33-35-31(25-11-8-20(2)16-22(25)4)34-32(36-33)26-12-9-21(3)17-23(26)5/h7-13,16-18,38H,1,14-15,19H2,2-6H3 |
| InChIKey | RTCPLYIOYMIFFD-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 114.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|