C23H36N4O2 — CID 169098988
1-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]-3-[4-(3-piperidin-1-ylcyclobutyl)oxyphenyl]urea (PubChem CID 169098988) has the molecular formula C23H36N4O2 and a molecular weight of 400.57 g/mol. Its IUPAC name is 1-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]-3-[4-(3-piperidin-1-ylcyclobutyl)oxyphenyl]urea.
| Compound Name | 1-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]-3-[4-(3-piperidin-1-ylcyclobutyl)oxyphenyl]urea |
|---|---|
| PubChem CID | 169098988 |
| Molecular Formula | C23H36N4O2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | 1-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]-3-[4-(3-piperidin-1-ylcyclobutyl)oxyphenyl]urea |
| SMILES | C[C@@H]1CCCN1CCNC(=O)Nc1ccc(OC2CC(N3CCCCC3)C2)cc1 |
| InChI | InChI=1S/C23H36N4O2/c1-18-6-5-14-26(18)15-11-24-23(28)25-19-7-9-21(10-8-19)29-22-16-20(17-22)27-12-3-2-4-13-27/h7-10,18,20,22H,2-6,11-17H2,1H3,(H2,24,25,28)/t18-,20?,22?/m1/s1 |
| InChIKey | BCFBHQDTZTXHRR-HOHBBMLPSA-N |
| XLogP | 3.69 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |