C23H36N4O3 — CID 169099000
1-[2-(4-hydroxypiperidin-1-yl)ethyl]-3-[4-(3-piperidin-1-ylcyclobutyl)oxyphenyl]urea (PubChem CID 169099000) has the molecular formula C23H36N4O3 and a molecular weight of 416.57 g/mol. Its IUPAC name is 1-[2-(4-hydroxypiperidin-1-yl)ethyl]-3-[4-(3-piperidin-1-ylcyclobutyl)oxyphenyl]urea.
| Compound Name | 1-[2-(4-hydroxypiperidin-1-yl)ethyl]-3-[4-(3-piperidin-1-ylcyclobutyl)oxyphenyl]urea |
|---|---|
| PubChem CID | 169099000 |
| Molecular Formula | C23H36N4O3 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | 1-[2-(4-hydroxypiperidin-1-yl)ethyl]-3-[4-(3-piperidin-1-ylcyclobutyl)oxyphenyl]urea |
| SMILES | O=C(NCCN1CCC(O)CC1)Nc1ccc(OC2CC(N3CCCCC3)C2)cc1 |
| InChI | InChI=1S/C23H36N4O3/c28-20-8-13-26(14-9-20)15-10-24-23(29)25-18-4-6-21(7-5-18)30-22-16-19(17-22)27-11-2-1-3-12-27/h4-7,19-20,22,28H,1-3,8-17H2,(H2,24,25,29) |
| InChIKey | JNIOIFIVRQRRMU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |