C13H9F2N4O2S- — CID 169099427
1-[2,3-difluoro-4-[(sulfinatoamino)methyl]phenyl]benzotriazole (PubChem CID 169099427) has the molecular formula C13H9F2N4O2S- and a molecular weight of 323.30 g/mol. Its IUPAC name is 1-[2,3-difluoro-4-[(sulfinatoamino)methyl]phenyl]benzotriazole.
| Compound Name | 1-[2,3-difluoro-4-[(sulfinatoamino)methyl]phenyl]benzotriazole |
|---|---|
| PubChem CID | 169099427 |
| Molecular Formula | C13H9F2N4O2S- |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 1-[2,3-difluoro-4-[(sulfinatoamino)methyl]phenyl]benzotriazole |
| SMILES | O=S([O-])NCc1ccc(-n2nnc3ccccc32)c(F)c1F |
| InChI | InChI=1S/C13H10F2N4O2S/c14-12-8(7-16-22(20)21)5-6-11(13(12)15)19-10-4-2-1-3-9(10)17-18-19/h1-6,16H,7H2,(H,20,21)/p-1 |
| InChIKey | KJICBEDHHXJMRV-UHFFFAOYSA-M |
| XLogP | 1.58 |
| TPSA | 82.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|