About 6-(benzotriazol-1-yl)-2,3-dibutylphenol
6-(benzotriazol-1-yl)-2,3-dibutylphenol (PubChem CID 22931522) has the molecular formula C20H25N3O
and a molecular weight of 323.44 g/mol. Its IUPAC name is 6-(benzotriazol-1-yl)-2,3-dibutylphenol.
Molecular Properties
| Compound Name | 6-(benzotriazol-1-yl)-2,3-dibutylphenol |
| PubChem CID | 22931522 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 6-(benzotriazol-1-yl)-2,3-dibutylphenol |
| SMILES | CCCCc1ccc(-n2nnc3ccccc32)c(O)c1CCCC |
| InChI | InChI=1S/C20H25N3O/c1-3-5-9-15-13-14-19(20(24)16(15)10-6-4-2)23-18-12-8-7-11-17(18)21-22-23/h7-8,11-14,24H,3-6,9-10H2,1-2H3 |
| InChIKey | DJIQFOICLAILCH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(benzotriazol-1-yl)-2,3-dibutylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(benzotriazol-1-yl)-2,3-dibutylphenol?
The IUPAC name of 6-(benzotriazol-1-yl)-2,3-dibutylphenol (CID 22931522) is 6-(benzotriazol-1-yl)-2,3-dibutylphenol.
What is the SMILES notation for 6-(benzotriazol-1-yl)-2,3-dibutylphenol?
The canonical SMILES for 6-(benzotriazol-1-yl)-2,3-dibutylphenol is CCCCc1ccc(-n2nnc3ccccc32)c(O)c1CCCC.
What is the InChIKey of 6-(benzotriazol-1-yl)-2,3-dibutylphenol?
The InChIKey is DJIQFOICLAILCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N3O/c1-3-5-9-15-13-14-19(20(24)16(15)10-6-4-2)23-18-12-8-7-11-17(18)21-22-23/h7-8,11-14,24H,3-6,9-10H2,1-2H3.
What are the key properties of 6-(benzotriazol-1-yl)-2,3-dibutylphenol?
6-(benzotriazol-1-yl)-2,3-dibutylphenol has a molecular weight of 323.44 g/mol, XLogP of 4.81, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(benzotriazol-1-yl)-2,3-dibutylphenol is sourced from PubChem (CID 22931522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).