C9H12BrNO2 — CID 169101784
4-bromo-2,5-dimethylaniline;formic acid (PubChem CID 169101784) has the molecular formula C9H12BrNO2 and a molecular weight of 246.10 g/mol. Its IUPAC name is 4-bromo-2,5-dimethylaniline;formic acid.
| Compound Name | 4-bromo-2,5-dimethylaniline;formic acid |
|---|---|
| PubChem CID | 169101784 |
| Molecular Formula | C9H12BrNO2 |
| Molecular Weight | 246.10 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | 4-bromo-2,5-dimethylaniline;formic acid |
| SMILES | Cc1cc(Br)c(C)cc1N.O=CO |
| InChI | InChI=1S/C8H10BrN.CH2O2/c1-5-4-8(10)6(2)3-7(5)9;2-1-3/h3-4H,10H2,1-2H3;1H,(H,2,3) |
| InChIKey | UFNZLUWICCFMLR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.10 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|