C11H21NO4S — CID 169102383
tert-butyl (4R)-4-butyl-2-oxooxathiazolidine-3-carboxylate (PubChem CID 169102383) has the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. Its IUPAC name is tert-butyl (4R)-4-butyl-2-oxooxathiazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-butyl-2-oxooxathiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 169102383 |
| Molecular Formula | C11H21NO4S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | tert-butyl (4R)-4-butyl-2-oxooxathiazolidine-3-carboxylate |
| SMILES | CCCC[C@@H]1COS(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H21NO4S/c1-5-6-7-9-8-15-17(14)12(9)10(13)16-11(2,3)4/h9H,5-8H2,1-4H3/t9-,17?/m1/s1 |
| InChIKey | SHCDOGLDMJISER-SUSUGVNDSA-N |
| XLogP | 2.39 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |