C8H14FNO4S — CID 170603940
tert-butyl (4S)-4-(fluoromethyl)-2-oxooxathiazolidine-3-carboxylate (PubChem CID 170603940) has the molecular formula C8H14FNO4S and a molecular weight of 239.27 g/mol. Its IUPAC name is tert-butyl (4S)-4-(fluoromethyl)-2-oxooxathiazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-(fluoromethyl)-2-oxooxathiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 170603940 |
| Molecular Formula | C8H14FNO4S |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | tert-butyl (4S)-4-(fluoromethyl)-2-oxooxathiazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](CF)COS1=O |
| InChI | InChI=1S/C8H14FNO4S/c1-8(2,3)14-7(11)10-6(4-9)5-13-15(10)12/h6H,4-5H2,1-3H3/t6-,15?/m1/s1 |
| InChIKey | HIKHJVOLAIPIEM-WVEXHBNRSA-N |
| XLogP | 1.17 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |