C21H27BrFNO7 — CID 169103706
dimethyl 4-[bromo-[4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methyl]-5-fluorobenzene-1,2-dicarboxylate (PubChem CID 169103706) has the molecular formula C21H27BrFNO7 and a molecular weight of 504.35 g/mol. Its IUPAC name is dimethyl 4-[bromo-[4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methyl]-5-fluorobenzene-1,2-dicarboxylate.
| Compound Name | dimethyl 4-[bromo-[4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methyl]-5-fluorobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 169103706 |
| Molecular Formula | C21H27BrFNO7 |
| Molecular Weight | 504.35 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | dimethyl 4-[bromo-[4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methyl]-5-fluorobenzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1cc(F)c(C(Br)C2(O)CCN(C(=O)OC(C)(C)C)CC2)cc1C(=O)OC |
| InChI | InChI=1S/C21H27BrFNO7/c1-20(2,3)31-19(27)24-8-6-21(28,7-9-24)16(22)14-10-12(17(25)29-4)13(11-15(14)23)18(26)30-5/h10-11,16,28H,6-9H2,1-5H3 |
| InChIKey | WZGJIDABCVJBQH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|