C21H27NO — CID 169105949
N-[(E)-1,2-diphenylprop-1-enyl]propan-2-imine;propan-1-ol (PubChem CID 169105949) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is N-[(E)-1,2-diphenylprop-1-enyl]propan-2-imine;propan-1-ol.
| Compound Name | N-[(E)-1,2-diphenylprop-1-enyl]propan-2-imine;propan-1-ol |
|---|---|
| PubChem CID | 169105949 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | N-[(E)-1,2-diphenylprop-1-enyl]propan-2-imine;propan-1-ol |
| SMILES | CC(C)=N/C(=C(\C)c1ccccc1)c1ccccc1.CCCO |
| InChI | InChI=1S/C18H19N.C3H8O/c1-14(2)19-18(17-12-8-5-9-13-17)15(3)16-10-6-4-7-11-16;1-2-3-4/h4-13H,1-3H3;4H,2-3H2,1H3/b18-15+; |
| InChIKey | NIOXCJLAFWKKED-FLNCGGNMSA-N |
| XLogP | 5.44 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|