C13H24O4S — CID 169106860
(3S,7aS)-3,3a,4,6,7,7a-hexahydro-2H-thiopyrano[4,3-b]furan-3-ol;2,2,4-trimethyl-1,3-dioxolane (PubChem CID 169106860) has the molecular formula C13H24O4S and a molecular weight of 276.40 g/mol. Its IUPAC name is (3S,7aS)-3,3a,4,6,7,7a-hexahydro-2H-thiopyrano[4,3-b]furan-3-ol;2,2,4-trimethyl-1,3-dioxolane.
| Compound Name | (3S,7aS)-3,3a,4,6,7,7a-hexahydro-2H-thiopyrano[4,3-b]furan-3-ol;2,2,4-trimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 169106860 |
| Molecular Formula | C13H24O4S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (3S,7aS)-3,3a,4,6,7,7a-hexahydro-2H-thiopyrano[4,3-b]furan-3-ol;2,2,4-trimethyl-1,3-dioxolane |
| SMILES | CC1COC(C)(C)O1.O[C@@H]1CO[C@H]2CCSCC12 |
| InChI | InChI=1S/C7H12O2S.C6H12O2/c8-6-3-9-7-1-2-10-4-5(6)7;1-5-4-7-6(2,3)8-5/h5-8H,1-4H2;5H,4H2,1-3H3/t5?,6-,7+;/m1./s1 |
| InChIKey | QQKYASMSSOSXPF-ABIAQHQTSA-N |
| XLogP | 1.66 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |