C18H19BF3NO2 — CID 169108310
N-[4-(trifluoromethyl)phenyl]-2-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 169108310) has the molecular formula C18H19BF3NO2 and a molecular weight of 349.16 g/mol. Its IUPAC name is N-[4-(trifluoromethyl)phenyl]-2-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | N-[4-(trifluoromethyl)phenyl]-2-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 169108310 |
| Molecular Formula | C18H19BF3NO2 |
| Molecular Weight | 349.16 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-[4-(trifluoromethyl)phenyl]-2-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | CC1OB(c2ccccc2Nc2ccc(C(F)(F)F)cc2)OC1(C)C |
| InChI | InChI=1S/C18H19BF3NO2/c1-12-17(2,3)25-19(24-12)15-6-4-5-7-16(15)23-14-10-8-13(9-11-14)18(20,21)22/h4-12,23H,1-3H3 |
| InChIKey | OPDINNRQUDQGMN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.16 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|