C20H29BF3NO3 — CID 132937327
2-ethyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-N-[4-(trifluoromethyl)phenyl]butanamide (PubChem CID 132937327) has the molecular formula C20H29BF3NO3 and a molecular weight of 399.26 g/mol. Its IUPAC name is 2-ethyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-N-[4-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 2-ethyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-N-[4-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 132937327 |
| Molecular Formula | C20H29BF3NO3 |
| Molecular Weight | 399.26 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 2-ethyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-N-[4-(trifluoromethyl)phenyl]butanamide |
| SMILES | CCC(CC)(CB1OC(C)(C)C(C)(C)O1)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H29BF3NO3/c1-7-19(8-2,13-21-27-17(3,4)18(5,6)28-21)16(26)25-15-11-9-14(10-12-15)20(22,23)24/h9-12H,7-8,13H2,1-6H3,(H,25,26) |
| InChIKey | IAZQJNWZYMINRN-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.26 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|